C15H26N6O2 — CID 60616938
4-[2-(butan-2-ylamino)-2-oxoethyl]-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide (PubChem CID 60616938) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[2-(butan-2-ylamino)-2-oxoethyl]-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(butan-2-ylamino)-2-oxoethyl]-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60616938 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-[2-(butan-2-ylamino)-2-oxoethyl]-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)Nc2ccn(C)n2)CC1 |
| InChI | InChI=1S/C15H26N6O2/c1-4-12(2)16-14(22)11-20-7-9-21(10-8-20)15(23)17-13-5-6-19(3)18-13/h5-6,12H,4,7-11H2,1-3H3,(H,16,22)(H,17,18,23) |
| InChIKey | XIMUQXJASNFYST-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |