C23H20N2O3 — CID 60617132
N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-(4-phenylphenyl)acetamide (PubChem CID 60617132) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 60617132 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[2-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccccc1N1CCOC1=O |
| InChI | InChI=1S/C23H20N2O3/c26-22(16-17-10-12-19(13-11-17)18-6-2-1-3-7-18)24-20-8-4-5-9-21(20)25-14-15-28-23(25)27/h1-13H,14-16H2,(H,24,26) |
| InChIKey | BJGCTMRVENXUCU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |