C16H21N3O3S — CID 60617583
5-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 60617583) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 5-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60617583 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | CC1CCN(C(=O)CN2C(=O)NC(C)(c3ccsc3)C2=O)CC1 |
| InChI | InChI=1S/C16H21N3O3S/c1-11-3-6-18(7-4-11)13(20)9-19-14(21)16(2,17-15(19)22)12-5-8-23-10-12/h5,8,10-11H,3-4,6-7,9H2,1-2H3,(H,17,22) |
| InChIKey | GISOCANBIZKPDL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|