About tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate
tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate (PubChem CID 60618706) has the molecular formula C17H27N3O4
and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate |
| PubChem CID | 60618706 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate |
| SMILES | CN(C)CCN(CC(=O)OC(C)(C)C)C(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,3)23-15(21)11-20(9-8-19(4)5)16(22)13-10-14(24-18-13)12-6-7-12/h10,12H,6-9,11H2,1-5H3 |
| InChIKey | VLEZSMXATFCPEU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate?
The IUPAC name of tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate (CID 60618706) is tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate.
What is the SMILES notation for tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate?
The canonical SMILES for tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate is CN(C)CCN(CC(=O)OC(C)(C)C)C(=O)c1cc(C2CC2)on1.
What is the InChIKey of tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate?
The InChIKey is VLEZSMXATFCPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O4/c1-17(2,3)23-15(21)11-20(9-8-19(4)5)16(22)13-10-14(24-18-13)12-6-7-12/h10,12H,6-9,11H2,1-5H3.
What are the key properties of tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate?
tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate has a molecular weight of 337.42 g/mol, XLogP of 1.90, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(5-cyclopropyl-1,2-oxazole-3-carbonyl)-[2-(dimethylamino)ethyl]amino]acetate is sourced from PubChem (CID 60618706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).