About 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone
1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone (PubChem CID 606189) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone.
Molecular Properties
| Compound Name | 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone |
| PubChem CID | 606189 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone |
| SMILES | CC(=O)C12CC3CC(CC(C3)C13OCCO3)C2 |
| InChI | InChI=1S/C14H20O3/c1-9(15)13-7-10-4-11(8-13)6-12(5-10)14(13)16-2-3-17-14/h10-12H,2-8H2,1H3 |
| InChIKey | QYZUXPQHBRUDQD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone?
The IUPAC name of 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone (CID 606189) is 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone.
What is the SMILES notation for 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone?
The canonical SMILES for 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone is CC(=O)C12CC3CC(CC(C3)C13OCCO3)C2.
What is the InChIKey of 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone?
The InChIKey is QYZUXPQHBRUDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-9(15)13-7-10-4-11(8-13)6-12(5-10)14(13)16-2-3-17-14/h10-12H,2-8H2,1H3.
What are the key properties of 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone?
1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone has a molecular weight of 236.31 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[1,3-dioxolane-2,2'-adamantane]-1'-ylethanone is sourced from PubChem (CID 606189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).