C19H22N2O3 — CID 60619140
5,5-dicyclopropyl-3-[2-(3,4-dimethylphenyl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 60619140) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-[2-(3,4-dimethylphenyl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dicyclopropyl-3-[2-(3,4-dimethylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60619140 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5,5-dicyclopropyl-3-[2-(3,4-dimethylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)CN2C(=O)NC(C3CC3)(C3CC3)C2=O)cc1C |
| InChI | InChI=1S/C19H22N2O3/c1-11-3-4-13(9-12(11)2)16(22)10-21-17(23)19(14-5-6-14,15-7-8-15)20-18(21)24/h3-4,9,14-15H,5-8,10H2,1-2H3,(H,20,24) |
| InChIKey | YJNCMWVTJYAKIZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|