C17H23N3O3 — CID 60620086
N-hexyl-2-[3-(2-methylphenyl)-5-oxo-1,2,4-oxadiazol-4-yl]acetamide (PubChem CID 60620086) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-hexyl-2-[3-(2-methylphenyl)-5-oxo-1,2,4-oxadiazol-4-yl]acetamide.
| Compound Name | N-hexyl-2-[3-(2-methylphenyl)-5-oxo-1,2,4-oxadiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 60620086 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-hexyl-2-[3-(2-methylphenyl)-5-oxo-1,2,4-oxadiazol-4-yl]acetamide |
| SMILES | CCCCCCNC(=O)Cn1c(-c2ccccc2C)noc1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-4-5-8-11-18-15(21)12-20-16(19-23-17(20)22)14-10-7-6-9-13(14)2/h6-7,9-10H,3-5,8,11-12H2,1-2H3,(H,18,21) |
| InChIKey | FLQZEJHFEQCCFW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|