C24H31N3O3S — CID 60620575
N-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 60620575) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 60620575 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NCc2cccc(CN3CCC(C)CC3)c2)cc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-3-13-26-31(29,30)23-9-7-22(8-10-23)24(28)25-17-20-5-4-6-21(16-20)18-27-14-11-19(2)12-15-27/h3-10,16,19,26H,1,11-15,17-18H2,2H3,(H,25,28) |
| InChIKey | XCCURHMICUEIIU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|