About (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate
(2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate (PubChem CID 60620724) has the molecular formula C17H13N3O4S
and a molecular weight of 355.38 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate.
Molecular Properties
| Compound Name | (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate |
| PubChem CID | 60620724 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate |
| SMILES | Cc1ccc2cccc(OS(=O)(=O)c3cnc4onc(C)c4c3)c2n1 |
| InChI | InChI=1S/C17H13N3O4S/c1-10-6-7-12-4-3-5-15(16(12)19-10)24-25(21,22)13-8-14-11(2)20-23-17(14)18-9-13/h3-9H,1-2H3 |
| InChIKey | YMRBXGLOHFCUSG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate?
The IUPAC name of (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate (CID 60620724) is (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate.
What is the SMILES notation for (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate?
The canonical SMILES for (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate is Cc1ccc2cccc(OS(=O)(=O)c3cnc4onc(C)c4c3)c2n1.
What is the InChIKey of (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate?
The InChIKey is YMRBXGLOHFCUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O4S/c1-10-6-7-12-4-3-5-15(16(12)19-10)24-25(21,22)13-8-14-11(2)20-23-17(14)18-9-13/h3-9H,1-2H3.
What are the key properties of (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate?
(2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate has a molecular weight of 355.38 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylquinolin-8-yl) 3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonate is sourced from PubChem (CID 60620724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).