C20H31N3O3 — CID 60620853
tert-butyl N-[4-oxo-4-(2-piperidin-1-ylanilino)butyl]carbamate (PubChem CID 60620853) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-(2-piperidin-1-ylanilino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-(2-piperidin-1-ylanilino)butyl]carbamate |
|---|---|
| PubChem CID | 60620853 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl N-[4-oxo-4-(2-piperidin-1-ylanilino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C20H31N3O3/c1-20(2,3)26-19(25)21-13-9-12-18(24)22-16-10-5-6-11-17(16)23-14-7-4-8-15-23/h5-6,10-11H,4,7-9,12-15H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | REMPZROIZMBZHF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|