C23H25Cl2N3O2 — CID 60620932
4-(2,3-dichlorophenoxy)-1-[2-(1-ethylbenzimidazol-2-yl)pyrrolidin-1-yl]butan-1-one (PubChem CID 60620932) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-1-[2-(1-ethylbenzimidazol-2-yl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(2,3-dichlorophenoxy)-1-[2-(1-ethylbenzimidazol-2-yl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 60620932 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-1-[2-(1-ethylbenzimidazol-2-yl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CCn1c(C2CCCN2C(=O)CCCOc2cccc(Cl)c2Cl)nc2ccccc21 |
| InChI | InChI=1S/C23H25Cl2N3O2/c1-2-27-18-10-4-3-9-17(18)26-23(27)19-11-6-14-28(19)21(29)13-7-15-30-20-12-5-8-16(24)22(20)25/h3-5,8-10,12,19H,2,6-7,11,13-15H2,1H3 |
| InChIKey | YBCSOYOEXDFPKP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|