C18H29NO3S — CID 60621557
N-ethyl-N-(2-ethylbutyl)-2-propan-2-ylsulfonylbenzamide (PubChem CID 60621557) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is N-ethyl-N-(2-ethylbutyl)-2-propan-2-ylsulfonylbenzamide.
| Compound Name | N-ethyl-N-(2-ethylbutyl)-2-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60621557 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-ethyl-N-(2-ethylbutyl)-2-propan-2-ylsulfonylbenzamide |
| SMILES | CCC(CC)CN(CC)C(=O)c1ccccc1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C18H29NO3S/c1-6-15(7-2)13-19(8-3)18(20)16-11-9-10-12-17(16)23(21,22)14(4)5/h9-12,14-15H,6-8,13H2,1-5H3 |
| InChIKey | PBMHVRKASSMQSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |