About N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide
N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide (PubChem CID 60621716) has the molecular formula C17H24ClNO3
and a molecular weight of 325.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 60621716 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide |
| SMILES | CCC(CC)(CNC(=O)C1COCCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClNO3/c1-3-17(4-2,13-5-7-14(18)8-6-13)12-19-16(20)15-11-21-9-10-22-15/h5-8,15H,3-4,9-12H2,1-2H3,(H,19,20) |
| InChIKey | WCQQWWNYVNBDMB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide?
The IUPAC name of N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide (CID 60621716) is N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide is CCC(CC)(CNC(=O)C1COCCO1)c1ccc(Cl)cc1.
What is the InChIKey of N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide?
The InChIKey is WCQQWWNYVNBDMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClNO3/c1-3-17(4-2,13-5-7-14(18)8-6-13)12-19-16(20)15-11-21-9-10-22-15/h5-8,15H,3-4,9-12H2,1-2H3,(H,19,20).
What are the key properties of N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide?
N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide has a molecular weight of 325.84 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenyl)-2-ethylbutyl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 60621716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).