C19H26Cl2N2O2 — CID 60622118
N-[1-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]piperidin-3-yl]butanamide (PubChem CID 60622118) has the molecular formula C19H26Cl2N2O2 and a molecular weight of 385.34 g/mol. Its IUPAC name is N-[1-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]piperidin-3-yl]butanamide.
| Compound Name | N-[1-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 60622118 |
| Molecular Formula | C19H26Cl2N2O2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[1-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]piperidin-3-yl]butanamide |
| SMILES | CCCC(=O)NC1CCCN(C(=O)C(C)(C)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H26Cl2N2O2/c1-4-6-17(24)22-14-7-5-10-23(12-14)18(25)19(2,3)13-8-9-15(20)16(21)11-13/h8-9,11,14H,4-7,10,12H2,1-3H3,(H,22,24) |
| InChIKey | UVQVJWUIVSHYGS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |