C21H23FIN3O2 — CID 60622476
N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-5-fluoro-2-iodobenzamide (PubChem CID 60622476) has the molecular formula C21H23FIN3O2 and a molecular weight of 495.34 g/mol. Its IUPAC name is N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-5-fluoro-2-iodobenzamide.
| Compound Name | N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-5-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 60622476 |
| Molecular Formula | C21H23FIN3O2 |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | N-[3-[[2-(azepan-1-yl)acetyl]amino]phenyl]-5-fluoro-2-iodobenzamide |
| SMILES | O=C(CN1CCCCCC1)Nc1cccc(NC(=O)c2cc(F)ccc2I)c1 |
| InChI | InChI=1S/C21H23FIN3O2/c22-15-8-9-19(23)18(12-15)21(28)25-17-7-5-6-16(13-17)24-20(27)14-26-10-3-1-2-4-11-26/h5-9,12-13H,1-4,10-11,14H2,(H,24,27)(H,25,28) |
| InChIKey | WBAQWLGDXKHCPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|