C16H15IN4O4 — CID 60622962
N-[3-(ethylcarbamoylamino)phenyl]-2-iodo-4-nitrobenzamide (PubChem CID 60622962) has the molecular formula C16H15IN4O4 and a molecular weight of 454.22 g/mol. Its IUPAC name is N-[3-(ethylcarbamoylamino)phenyl]-2-iodo-4-nitrobenzamide.
| Compound Name | N-[3-(ethylcarbamoylamino)phenyl]-2-iodo-4-nitrobenzamide |
|---|---|
| PubChem CID | 60622962 |
| Molecular Formula | C16H15IN4O4 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | N-[3-(ethylcarbamoylamino)phenyl]-2-iodo-4-nitrobenzamide |
| SMILES | CCNC(=O)Nc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2I)c1 |
| InChI | InChI=1S/C16H15IN4O4/c1-2-18-16(23)20-11-5-3-4-10(8-11)19-15(22)13-7-6-12(21(24)25)9-14(13)17/h3-9H,2H2,1H3,(H,19,22)(H2,18,20,23) |
| InChIKey | XYNMSKRSZMTCAV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|