C6H7N7O — CID 606239
4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbohydrazide (PubChem CID 606239) has the molecular formula C6H7N7O and a molecular weight of 193.17 g/mol. Its IUPAC name is 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbohydrazide.
| Compound Name | 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbohydrazide |
|---|---|
| PubChem CID | 606239 |
| Molecular Formula | C6H7N7O |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbohydrazide |
| SMILES | NNC(=O)c1nnc2ccnn2c1N |
| InChI | InChI=1S/C6H7N7O/c7-5-4(6(14)10-8)12-11-3-1-2-9-13(3)5/h1-2H,7-8H2,(H,10,14) |
| InChIKey | JVUHKCVXEKCLAH-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|