C16H10Cl2O3 — CID 60623980
1-(1-benzofuran-2-yl)-2-(3,5-dichlorophenoxy)ethanone (PubChem CID 60623980) has the molecular formula C16H10Cl2O3 and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(3,5-dichlorophenoxy)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(3,5-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 60623980 |
| Molecular Formula | C16H10Cl2O3 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(3,5-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H10Cl2O3/c17-11-6-12(18)8-13(7-11)20-9-14(19)16-5-10-3-1-2-4-15(10)21-16/h1-8H,9H2 |
| InChIKey | PVEDTUQIWSRGQD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |