C14H19NO3 — CID 60624295
2-(3-formylphenoxy)-N-pentan-3-ylacetamide (PubChem CID 60624295) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(3-formylphenoxy)-N-pentan-3-ylacetamide.
| Compound Name | 2-(3-formylphenoxy)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 60624295 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(3-formylphenoxy)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)COc1cccc(C=O)c1 |
| InChI | InChI=1S/C14H19NO3/c1-3-12(4-2)15-14(17)10-18-13-7-5-6-11(8-13)9-16/h5-9,12H,3-4,10H2,1-2H3,(H,15,17) |
| InChIKey | CJRYPADDYBHHCO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|