C17H17ClO2S — CID 60624649
1-[3-[(2-chlorophenyl)sulfanylmethyl]-4-ethoxyphenyl]ethanone (PubChem CID 60624649) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is 1-[3-[(2-chlorophenyl)sulfanylmethyl]-4-ethoxyphenyl]ethanone.
| Compound Name | 1-[3-[(2-chlorophenyl)sulfanylmethyl]-4-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 60624649 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-[3-[(2-chlorophenyl)sulfanylmethyl]-4-ethoxyphenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1CSc1ccccc1Cl |
| InChI | InChI=1S/C17H17ClO2S/c1-3-20-16-9-8-13(12(2)19)10-14(16)11-21-17-7-5-4-6-15(17)18/h4-10H,3,11H2,1-2H3 |
| InChIKey | JAVMSXCEUWPECC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |