About 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile (PubChem CID 60626148) has the molecular formula C7H10N4S
and a molecular weight of 182.25 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile.
Molecular Properties
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile |
| PubChem CID | 60626148 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile |
| SMILES | Cc1nnc(SC(C)C#N)n1C |
| InChI | InChI=1S/C7H10N4S/c1-5(4-8)12-7-10-9-6(2)11(7)3/h5H,1-3H3 |
| InChIKey | STRZPPZLIZRPEN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile?
The IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile (CID 60626148) is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile.
What is the SMILES notation for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile?
The canonical SMILES for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile is Cc1nnc(SC(C)C#N)n1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile?
The InChIKey is STRZPPZLIZRPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4S/c1-5(4-8)12-7-10-9-6(2)11(7)3/h5H,1-3H3.
What are the key properties of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile?
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile has a molecular weight of 182.25 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanenitrile is sourced from PubChem (CID 60626148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).