C11H12N4S — CID 60626204
5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanenitrile (PubChem CID 60626204) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanenitrile.
| Compound Name | 5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanenitrile |
|---|---|
| PubChem CID | 60626204 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanenitrile |
| SMILES | N#CCCCCSc1nnc2ccccn12 |
| InChI | InChI=1S/C11H12N4S/c12-7-3-1-5-9-16-11-14-13-10-6-2-4-8-15(10)11/h2,4,6,8H,1,3,5,9H2 |
| InChIKey | BKSLSFHIQFHAJW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|