About 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one
2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one (PubChem CID 60627063) has the molecular formula C12H16N2OS
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one.
Molecular Properties
| Compound Name | 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one |
| PubChem CID | 60627063 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one |
| SMILES | Cc1nc(SC2CCCC2=O)nc(C)c1C |
| InChI | InChI=1S/C12H16N2OS/c1-7-8(2)13-12(14-9(7)3)16-11-6-4-5-10(11)15/h11H,4-6H2,1-3H3 |
| InChIKey | ORKBPFACWYCWBA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one?
The IUPAC name of 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one (CID 60627063) is 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one.
What is the SMILES notation for 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one?
The canonical SMILES for 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one is Cc1nc(SC2CCCC2=O)nc(C)c1C.
What is the InChIKey of 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one?
The InChIKey is ORKBPFACWYCWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OS/c1-7-8(2)13-12(14-9(7)3)16-11-6-4-5-10(11)15/h11H,4-6H2,1-3H3.
What are the key properties of 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one?
2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one has a molecular weight of 236.34 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylcyclopentan-1-one is sourced from PubChem (CID 60627063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).