C15H21N3O3 — CID 60627642
3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]-5-propylimidazolidine-2,4-dione (PubChem CID 60627642) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60627642 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(CC(=O)c2cc(C)n(C)c2C)C1=O |
| InChI | InChI=1S/C15H21N3O3/c1-5-6-12-14(20)18(15(21)16-12)8-13(19)11-7-9(2)17(4)10(11)3/h7,12H,5-6,8H2,1-4H3,(H,16,21) |
| InChIKey | RPFLNSJUFQIWEF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|