About 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene
2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene (PubChem CID 60627982) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene |
| PubChem CID | 60627982 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(COc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H24O/c1-14-6-7-15(2)16(12-14)13-20-18-10-8-17(9-11-18)19(3,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | QKMQJXJCVWUFAK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene?
The IUPAC name of 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene (CID 60627982) is 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene.
What is the SMILES notation for 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene?
The canonical SMILES for 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene is Cc1ccc(C)c(COc2ccc(C(C)(C)C)cc2)c1.
What is the InChIKey of 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene?
The InChIKey is QKMQJXJCVWUFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O/c1-14-6-7-15(2)16(12-14)13-20-18-10-8-17(9-11-18)19(3,4)5/h6-12H,13H2,1-5H3.
What are the key properties of 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene?
2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene has a molecular weight of 268.40 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-tert-butylphenoxy)methyl]-1,4-dimethylbenzene is sourced from PubChem (CID 60627982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).