C14H10BrCl2NO2 — CID 60629817
2-bromo-N-(2,6-dichlorophenyl)-5-methoxybenzamide (PubChem CID 60629817) has the molecular formula C14H10BrCl2NO2 and a molecular weight of 375.05 g/mol. Its IUPAC name is 2-bromo-N-(2,6-dichlorophenyl)-5-methoxybenzamide.
| Compound Name | 2-bromo-N-(2,6-dichlorophenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 60629817 |
| Molecular Formula | C14H10BrCl2NO2 |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 2-bromo-N-(2,6-dichlorophenyl)-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H10BrCl2NO2/c1-20-8-5-6-10(15)9(7-8)14(19)18-13-11(16)3-2-4-12(13)17/h2-7H,1H3,(H,18,19) |
| InChIKey | MQNSIQOTYUGSAE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |