About 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile
3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile (PubChem CID 606302) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile |
| PubChem CID | 606302 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile |
| SMILES | CN1CC(CCC#N)C(=O)C(C)(CCC#N)C1 |
| InChI | InChI=1S/C13H19N3O/c1-13(6-4-8-15)10-16(2)9-11(12(13)17)5-3-7-14/h11H,3-6,9-10H2,1-2H3 |
| InChIKey | ARSPDUNBNCTXSK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile?
The IUPAC name of 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile (CID 606302) is 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile.
What is the SMILES notation for 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile?
The canonical SMILES for 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile is CN1CC(CCC#N)C(=O)C(C)(CCC#N)C1.
What is the InChIKey of 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile?
The InChIKey is ARSPDUNBNCTXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-13(6-4-8-15)10-16(2)9-11(12(13)17)5-3-7-14/h11H,3-6,9-10H2,1-2H3.
What are the key properties of 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile?
3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile has a molecular weight of 233.31 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2-cyanoethyl)-1,5-dimethyl-4-oxopiperidin-3-yl]propanenitrile is sourced from PubChem (CID 606302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).