phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate

C13H13NO2S — CID 60631092

IUPACphenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate
SMILESCN(Cc1cccs1)C(=O)Oc1ccccc1
InChIInChI=1S/C13H13NO2S/c1-14(10-12-8-5-9-17-12)13(15)16-11-6-3-2-4-7-11/h2-9H,10H2,1H3
InChIKeyZAVFMGYIGYAGAU-UHFFFAOYSA-N
MW247.32 g/mol
LogP3.38
Rot. Bonds3

About phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate

phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 60631092) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate.

Molecular Properties

Compound Namephenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate
PubChem CID60631092
Molecular FormulaC13H13NO2S
Molecular Weight247.32 g/mol
Exact Mass247.07
IUPAC Namephenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate
SMILESCN(Cc1cccs1)C(=O)Oc1ccccc1
InChIInChI=1S/C13H13NO2S/c1-14(10-12-8-5-9-17-12)13(15)16-11-6-3-2-4-7-11/h2-9H,10H2,1H3
InChIKeyZAVFMGYIGYAGAU-UHFFFAOYSA-N
XLogP3.38
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.32
LogP ≤ 53.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate?
The IUPAC name of phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate (CID 60631092) is phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate.
What is the SMILES notation for phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate?
The canonical SMILES for phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate is CN(Cc1cccs1)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate?
The InChIKey is ZAVFMGYIGYAGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2S/c1-14(10-12-8-5-9-17-12)13(15)16-11-6-3-2-4-7-11/h2-9H,10H2,1H3.
What are the key properties of phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate?
phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate has a molecular weight of 247.32 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-methyl-N-(thiophen-2-ylmethyl)carbamate is sourced from PubChem (CID 60631092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).