C22H20Cl4N2O2 — CID 6063194
(E)-3-(3,4-dichlorophenyl)-N-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide (PubChem CID 6063194) has the molecular formula C22H20Cl4N2O2 and a molecular weight of 486.23 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 6063194 |
| Molecular Formula | C22H20Cl4N2O2 |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCNC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl4N2O2/c23-17-7-3-15(13-19(17)25)5-9-21(29)27-11-1-2-12-28-22(30)10-6-16-4-8-18(24)20(26)14-16/h3-10,13-14H,1-2,11-12H2,(H,27,29)(H,28,30)/b9-5+,10-6+ |
| InChIKey | ZMXCVSCGVWRDTJ-NXZHAISVSA-N |
| XLogP | 6.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|