methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate

C10H15N3O2 — CID 60631998

IUPACmethyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate
SMILESCOC(=O)CCNc1nc(C)cnc1C
InChIInChI=1S/C10H15N3O2/c1-7-6-12-8(2)10(13-7)11-5-4-9(14)15-3/h6H,4-5H2,1-3H3,(H,11,13)
InChIKeyRIOBJWZIHVFIPG-UHFFFAOYSA-N
MW209.25 g/mol
LogP1.07
Rot. Bonds4

About methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate

methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate (PubChem CID 60631998) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate
PubChem CID60631998
Molecular FormulaC10H15N3O2
Molecular Weight209.25 g/mol
Exact Mass209.12
IUPAC Namemethyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate
SMILESCOC(=O)CCNc1nc(C)cnc1C
InChIInChI=1S/C10H15N3O2/c1-7-6-12-8(2)10(13-7)11-5-4-9(14)15-3/h6H,4-5H2,1-3H3,(H,11,13)
InChIKeyRIOBJWZIHVFIPG-UHFFFAOYSA-N
XLogP1.07
TPSA64.11 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 51.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate?
The IUPAC name of methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate (CID 60631998) is methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate.
What is the SMILES notation for methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate?
The canonical SMILES for methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate is COC(=O)CCNc1nc(C)cnc1C.
What is the InChIKey of methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate?
The InChIKey is RIOBJWZIHVFIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-7-6-12-8(2)10(13-7)11-5-4-9(14)15-3/h6H,4-5H2,1-3H3,(H,11,13).
What are the key properties of methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate?
methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate has a molecular weight of 209.25 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,6-dimethylpyrazin-2-yl)amino]propanoate is sourced from PubChem (CID 60631998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).