About 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol
1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol (PubChem CID 60632594) has the molecular formula C13H26F3NO2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol |
| PubChem CID | 60632594 |
| Molecular Formula | C13H26F3NO2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol |
| SMILES | CCCCCCCCOCC(O)CNCC(F)(F)F |
| InChI | InChI=1S/C13H26F3NO2/c1-2-3-4-5-6-7-8-19-10-12(18)9-17-11-13(14,15)16/h12,17-18H,2-11H2,1H3 |
| InChIKey | CLONKIAEQIBSOJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol?
The IUPAC name of 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol (CID 60632594) is 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol.
What is the SMILES notation for 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol?
The canonical SMILES for 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol is CCCCCCCCOCC(O)CNCC(F)(F)F.
What is the InChIKey of 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol?
The InChIKey is CLONKIAEQIBSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F3NO2/c1-2-3-4-5-6-7-8-19-10-12(18)9-17-11-13(14,15)16/h12,17-18H,2-11H2,1H3.
What are the key properties of 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol?
1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol has a molecular weight of 285.35 g/mol, XLogP of 2.88, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octoxy-3-(2,2,2-trifluoroethylamino)propan-2-ol is sourced from PubChem (CID 60632594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).