C15H25NO2S — CID 60633182
1-(2-methylcyclohexyl)oxy-3-(thiophen-2-ylmethylamino)propan-2-ol (PubChem CID 60633182) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)oxy-3-(thiophen-2-ylmethylamino)propan-2-ol.
| Compound Name | 1-(2-methylcyclohexyl)oxy-3-(thiophen-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60633182 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(2-methylcyclohexyl)oxy-3-(thiophen-2-ylmethylamino)propan-2-ol |
| SMILES | CC1CCCCC1OCC(O)CNCc1cccs1 |
| InChI | InChI=1S/C15H25NO2S/c1-12-5-2-3-7-15(12)18-11-13(17)9-16-10-14-6-4-8-19-14/h4,6,8,12-13,15-17H,2-3,5,7,9-11H2,1H3 |
| InChIKey | QMPWNUWRGNFZLD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |