C12H17N3O3 — CID 60634918
2-[2-(azepan-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione (PubChem CID 60634918) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 60634918 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H17N3O3/c16-10-5-6-11(17)15(13-10)9-12(18)14-7-3-1-2-4-8-14/h5-6H,1-4,7-9H2,(H,13,16) |
| InChIKey | YTMRFLDIAYQYFC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |