C18H18N4O — CID 6063523
(Z)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenylmethoxyphenyl)methanimine (PubChem CID 6063523) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is (Z)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenylmethoxyphenyl)methanimine.
| Compound Name | (Z)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 6063523 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (Z)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-phenylmethoxyphenyl)methanimine |
| SMILES | Cc1nnc(C)n1/N=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H18N4O/c1-14-20-21-15(2)22(14)19-12-17-9-6-10-18(11-17)23-13-16-7-4-3-5-8-16/h3-12H,13H2,1-2H3/b19-12- |
| InChIKey | MZCBHKHSASAZLL-UNOMPAQXSA-N |
| XLogP | 3.36 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|