C10H13N3O4 — CID 60635736
2-(2-morpholin-4-yl-2-oxoethyl)-1H-pyridazine-3,6-dione (PubChem CID 60635736) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(2-morpholin-4-yl-2-oxoethyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(2-morpholin-4-yl-2-oxoethyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 60635736 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-(2-morpholin-4-yl-2-oxoethyl)-1H-pyridazine-3,6-dione |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)N1CCOCC1 |
| InChI | InChI=1S/C10H13N3O4/c14-8-1-2-9(15)13(11-8)7-10(16)12-3-5-17-6-4-12/h1-2H,3-7H2,(H,11,14) |
| InChIKey | GBPATGJZMQDACU-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |