About 9-ethyl-10-methyl-9,10-dihydroanthracene
9-ethyl-10-methyl-9,10-dihydroanthracene (PubChem CID 606358) has the molecular formula C17H18
and a molecular weight of 222.33 g/mol. Its IUPAC name is 9-ethyl-10-methyl-9,10-dihydroanthracene.
Molecular Properties
| Compound Name | 9-ethyl-10-methyl-9,10-dihydroanthracene |
| PubChem CID | 606358 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 9-ethyl-10-methyl-9,10-dihydroanthracene |
| SMILES | CCC1c2ccccc2C(C)c2ccccc21 |
| InChI | InChI=1S/C17H18/c1-3-13-16-10-6-4-8-14(16)12(2)15-9-5-7-11-17(13)15/h4-13H,3H2,1-2H3 |
| InChIKey | BLUDKRGRBCWCHN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-ethyl-10-methyl-9,10-dihydroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-10-methyl-9,10-dihydroanthracene?
The IUPAC name of 9-ethyl-10-methyl-9,10-dihydroanthracene (CID 606358) is 9-ethyl-10-methyl-9,10-dihydroanthracene.
What is the SMILES notation for 9-ethyl-10-methyl-9,10-dihydroanthracene?
The canonical SMILES for 9-ethyl-10-methyl-9,10-dihydroanthracene is CCC1c2ccccc2C(C)c2ccccc21.
What is the InChIKey of 9-ethyl-10-methyl-9,10-dihydroanthracene?
The InChIKey is BLUDKRGRBCWCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18/c1-3-13-16-10-6-4-8-14(16)12(2)15-9-5-7-11-17(13)15/h4-13H,3H2,1-2H3.
What are the key properties of 9-ethyl-10-methyl-9,10-dihydroanthracene?
9-ethyl-10-methyl-9,10-dihydroanthracene has a molecular weight of 222.33 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-10-methyl-9,10-dihydroanthracene is sourced from PubChem (CID 606358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).