About 2-methoxy-N,N-dipropylacetamide
2-methoxy-N,N-dipropylacetamide (PubChem CID 60635961) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methoxy-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dipropylacetamide |
| PubChem CID | 60635961 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-methoxy-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COC |
| InChI | InChI=1S/C9H19NO2/c1-4-6-10(7-5-2)9(11)8-12-3/h4-8H2,1-3H3 |
| InChIKey | FSJHTGWTVMUIDM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dipropylacetamide?
The IUPAC name of 2-methoxy-N,N-dipropylacetamide (CID 60635961) is 2-methoxy-N,N-dipropylacetamide.
What is the SMILES notation for 2-methoxy-N,N-dipropylacetamide?
The canonical SMILES for 2-methoxy-N,N-dipropylacetamide is CCCN(CCC)C(=O)COC.
What is the InChIKey of 2-methoxy-N,N-dipropylacetamide?
The InChIKey is FSJHTGWTVMUIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-6-10(7-5-2)9(11)8-12-3/h4-8H2,1-3H3.
What are the key properties of 2-methoxy-N,N-dipropylacetamide?
2-methoxy-N,N-dipropylacetamide has a molecular weight of 173.26 g/mol, XLogP of 1.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dipropylacetamide is sourced from PubChem (CID 60635961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).