C14H16BrNO2 — CID 60636105
2-bromo-5-methoxy-N,N-bis(prop-2-enyl)benzamide (PubChem CID 60636105) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 2-bromo-5-methoxy-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 60636105 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-bromo-5-methoxy-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C14H16BrNO2/c1-4-8-16(9-5-2)14(17)12-10-11(18-3)6-7-13(12)15/h4-7,10H,1-2,8-9H2,3H3 |
| InChIKey | JCJREWFOLVVHBG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|