C10H21NO4 — CID 60636441
2-ethoxy-N,N-bis(2-methoxyethyl)acetamide (PubChem CID 60636441) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-ethoxy-N,N-bis(2-methoxyethyl)acetamide.
| Compound Name | 2-ethoxy-N,N-bis(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 60636441 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-ethoxy-N,N-bis(2-methoxyethyl)acetamide |
| SMILES | CCOCC(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C10H21NO4/c1-4-15-9-10(12)11(5-7-13-2)6-8-14-3/h4-9H2,1-3H3 |
| InChIKey | ZKZZNEPWEYVWML-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |