C13H17NO3 — CID 60636995
N-(2-methoxy-5-methylphenyl)-4-oxopentanamide (PubChem CID 60636995) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-4-oxopentanamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 60636995 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-4-oxopentanamide |
| SMILES | COc1ccc(C)cc1NC(=O)CCC(C)=O |
| InChI | InChI=1S/C13H17NO3/c1-9-4-6-12(17-3)11(8-9)14-13(16)7-5-10(2)15/h4,6,8H,5,7H2,1-3H3,(H,14,16) |
| InChIKey | NWVDNLGVDXJNHX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |