C12H17NO2 — CID 60637097
N,N-dimethyl-3-(3-methylphenoxy)propanamide (PubChem CID 60637097) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-methylphenoxy)propanamide.
| Compound Name | N,N-dimethyl-3-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 60637097 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N,N-dimethyl-3-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-10-5-4-6-11(9-10)15-8-7-12(14)13(2)3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | XDEZIEMWKDNVEO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |