C13H21N3O3S — CID 60638627
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(methylamino)propanamide (PubChem CID 60638627) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(methylamino)propanamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 60638627 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C13H21N3O3S/c1-9-6-7-11(20(18,19)16(4)5)8-12(9)15-13(17)10(2)14-3/h6-8,10,14H,1-5H3,(H,15,17) |
| InChIKey | XKOSKASQPUWEFC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |