C19H23NO3 — CID 6063866
5,5-dimethyl-2-[(E)-3-(2-phenylethylamino)prop-2-enoyl]cyclohexane-1,3-dione (PubChem CID 6063866) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(E)-3-(2-phenylethylamino)prop-2-enoyl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[(E)-3-(2-phenylethylamino)prop-2-enoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 6063866 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 5,5-dimethyl-2-[(E)-3-(2-phenylethylamino)prop-2-enoyl]cyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)/C=C/NCCc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C19H23NO3/c1-19(2)12-16(22)18(17(23)13-19)15(21)9-11-20-10-8-14-6-4-3-5-7-14/h3-7,9,11,18,20H,8,10,12-13H2,1-2H3/b11-9+ |
| InChIKey | RFMBAZVOLOQNBX-PKNBQFBNSA-N |
| XLogP | 2.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|