C13H10BrCl2NO2S2 — CID 60640706
4-bromo-2,6-dichloro-N-(2-methylsulfanylphenyl)benzenesulfonamide (PubChem CID 60640706) has the molecular formula C13H10BrCl2NO2S2 and a molecular weight of 427.17 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-methylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-methylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60640706 |
| Molecular Formula | C13H10BrCl2NO2S2 |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 424.87 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-methylsulfanylphenyl)benzenesulfonamide |
| SMILES | CSc1ccccc1NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H10BrCl2NO2S2/c1-20-12-5-3-2-4-11(12)17-21(18,19)13-9(15)6-8(14)7-10(13)16/h2-7,17H,1H3 |
| InChIKey | HINNWCAUJMLNIS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |