C12H17NO3 — CID 60643143
ethyl N-(3-propoxyphenyl)carbamate (PubChem CID 60643143) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl N-(3-propoxyphenyl)carbamate.
| Compound Name | ethyl N-(3-propoxyphenyl)carbamate |
|---|---|
| PubChem CID | 60643143 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl N-(3-propoxyphenyl)carbamate |
| SMILES | CCCOc1cccc(NC(=O)OCC)c1 |
| InChI | InChI=1S/C12H17NO3/c1-3-8-16-11-7-5-6-10(9-11)13-12(14)15-4-2/h5-7,9H,3-4,8H2,1-2H3,(H,13,14) |
| InChIKey | BSUJNERFPOHKFI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |