C8H5BrCl2F3NO2S — CID 60643619
4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60643619) has the molecular formula C8H5BrCl2F3NO2S and a molecular weight of 387.00 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60643619 |
| Molecular Formula | C8H5BrCl2F3NO2S |
| Molecular Weight | 387.00 g/mol |
| Exact Mass | 384.86 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)F)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H5BrCl2F3NO2S/c9-4-1-5(10)7(6(11)2-4)18(16,17)15-3-8(12,13)14/h1-2,15H,3H2 |
| InChIKey | UPGMZJINUCOPHF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.00 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |