C15H28N2 — CID 606438
1-ethyl-2,2,4a,7,7-pentamethyl-3,4,5,6-tetrahydro-1,8-naphthyridine (PubChem CID 606438) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-ethyl-2,2,4a,7,7-pentamethyl-3,4,5,6-tetrahydro-1,8-naphthyridine.
| Compound Name | 1-ethyl-2,2,4a,7,7-pentamethyl-3,4,5,6-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 606438 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-ethyl-2,2,4a,7,7-pentamethyl-3,4,5,6-tetrahydro-1,8-naphthyridine |
| SMILES | CCN1C2=NC(C)(C)CCC2(C)CCC1(C)C |
| InChI | InChI=1S/C15H28N2/c1-7-17-12-15(6,11-9-14(17,4)5)10-8-13(2,3)16-12/h7-11H2,1-6H3 |
| InChIKey | NNBGKYXNFFNNPL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |