About N-ethyl-2-(1,2,4-triazol-1-yl)acetamide
N-ethyl-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 60644414) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-ethyl-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 60644414 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-ethyl-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | CCNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C6H10N4O/c1-2-8-6(11)3-10-5-7-4-9-10/h4-5H,2-3H2,1H3,(H,8,11) |
| InChIKey | PYTSLYOAVZHFCP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-ethyl-2-(1,2,4-triazol-1-yl)acetamide (CID 60644414) is N-ethyl-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-ethyl-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-ethyl-2-(1,2,4-triazol-1-yl)acetamide is CCNC(=O)Cn1cncn1.
What is the InChIKey of N-ethyl-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is PYTSLYOAVZHFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-2-8-6(11)3-10-5-7-4-9-10/h4-5H,2-3H2,1H3,(H,8,11).
What are the key properties of N-ethyl-2-(1,2,4-triazol-1-yl)acetamide?
N-ethyl-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 154.17 g/mol, XLogP of -0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 60644414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).