About N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide
N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide (PubChem CID 60644682) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide.
Molecular Properties
| Compound Name | N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide |
| PubChem CID | 60644682 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide |
| SMILES | CCC(=O)NC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C13H23NO/c1-5-11(15)14-10-8-9-6-7-13(10,4)12(9,2)3/h9-10H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | GBMHHBUMFAXVJM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide?
The IUPAC name of N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide (CID 60644682) is N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide.
What is the SMILES notation for N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide?
The canonical SMILES for N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide is CCC(=O)NC1CC2CCC1(C)C2(C)C.
What is the InChIKey of N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide?
The InChIKey is GBMHHBUMFAXVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-11(15)14-10-8-9-6-7-13(10,4)12(9,2)3/h9-10H,5-8H2,1-4H3,(H,14,15).
What are the key properties of N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide?
N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide has a molecular weight of 209.33 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)propanamide is sourced from PubChem (CID 60644682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).