C19H14N2 — CID 606468
9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine (PubChem CID 606468) has the molecular formula C19H14N2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine.
| Compound Name | 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine |
|---|---|
| PubChem CID | 606468 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine |
| SMILES | Cc1cccc2c1-c1ncccc1/C2=N\c1ccccc1 |
| InChI | InChI=1S/C19H14N2/c1-13-7-5-10-15-17(13)19-16(11-6-12-20-19)18(15)21-14-8-3-2-4-9-14/h2-12H,1H3/b21-18- |
| InChIKey | YTLVNNCRRHHLLO-UZYVYHOESA-N |
| XLogP | 4.54 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|