About 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine
9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine (PubChem CID 606468) has the molecular formula C19H14N2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine.
Molecular Properties
| Compound Name | 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine |
| PubChem CID | 606468 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine |
| SMILES | Cc1cccc2c1-c1ncccc1/C2=N\c1ccccc1 |
| InChI | InChI=1S/C19H14N2/c1-13-7-5-10-15-17(13)19-16(11-6-12-20-19)18(15)21-14-8-3-2-4-9-14/h2-12H,1H3/b21-18- |
| InChIKey | YTLVNNCRRHHLLO-UZYVYHOESA-N |
| XLogP | 4.54 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine?
The IUPAC name of 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine (CID 606468) is 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine.
What is the SMILES notation for 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine?
The canonical SMILES for 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine is Cc1cccc2c1-c1ncccc1/C2=N\c1ccccc1.
What is the InChIKey of 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine?
The InChIKey is YTLVNNCRRHHLLO-UZYVYHOESA-N. The full InChI is InChI=1S/C19H14N2/c1-13-7-5-10-15-17(13)19-16(11-6-12-20-19)18(15)21-14-8-3-2-4-9-14/h2-12H,1H3/b21-18-.
What are the key properties of 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine?
9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine has a molecular weight of 270.33 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-N-phenylindeno[1,2-b]pyridin-5-imine is sourced from PubChem (CID 606468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).